C14H24N2O3 — CID 160747845
(2R)-2-(ethylamino)-3-(4-nitrophenyl)propan-1-ol;propane (PubChem CID 160747845) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is (2R)-2-(ethylamino)-3-(4-nitrophenyl)propan-1-ol;propane.
| Compound Name | (2R)-2-(ethylamino)-3-(4-nitrophenyl)propan-1-ol;propane |
|---|---|
| PubChem CID | 160747845 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (2R)-2-(ethylamino)-3-(4-nitrophenyl)propan-1-ol;propane |
| SMILES | CCC.CCN[C@@H](CO)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H16N2O3.C3H8/c1-2-12-10(8-14)7-9-3-5-11(6-4-9)13(15)16;1-3-2/h3-6,10,12,14H,2,7-8H2,1H3;3H2,1-2H3/t10-;/m1./s1 |
| InChIKey | RWKODDAGWZBSGB-HNCPQSOCSA-N |
| XLogP | 2.52 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|