C23H33N3O2S — CID 22884059
[(3S)-4-[(2R)-2-amino-3-sulfanylpropyl]-3-(2-propoxyethyl)piperazin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 22884059) has the molecular formula C23H33N3O2S and a molecular weight of 415.60 g/mol. Its IUPAC name is [(3S)-4-[(2R)-2-amino-3-sulfanylpropyl]-3-(2-propoxyethyl)piperazin-1-yl]-naphthalen-1-ylmethanone.
| Compound Name | [(3S)-4-[(2R)-2-amino-3-sulfanylpropyl]-3-(2-propoxyethyl)piperazin-1-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 22884059 |
| Molecular Formula | C23H33N3O2S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | [(3S)-4-[(2R)-2-amino-3-sulfanylpropyl]-3-(2-propoxyethyl)piperazin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | CCCOCC[C@H]1CN(C(=O)c2cccc3ccccc23)CCN1C[C@@H](N)CS |
| InChI | InChI=1S/C23H33N3O2S/c1-2-13-28-14-10-20-16-26(12-11-25(20)15-19(24)17-29)23(27)22-9-5-7-18-6-3-4-8-21(18)22/h3-9,19-20,29H,2,10-17,24H2,1H3/t19-,20+/m1/s1 |
| InChIKey | JPUHRBSBSUPDKP-UXHICEINSA-N |
| XLogP | 3.04 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|