C40H46N2O6S — CID 10652165
(2S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]-phenylmethoxycarbonylamino]butanoic acid (PubChem CID 10652165) has the molecular formula C40H46N2O6S and a molecular weight of 682.88 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]-phenylmethoxycarbonylamino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]-phenylmethoxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 10652165 |
| Molecular Formula | C40H46N2O6S |
| Molecular Weight | 682.88 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | (2S)-3-methyl-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropyl]-phenylmethoxycarbonylamino]butanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(C[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C40H46N2O6S/c1-29(2)35(36(43)44)42(38(46)47-27-30-18-10-6-11-19-30)26-34(41-37(45)48-39(3,4)5)28-49-40(31-20-12-7-13-21-31,32-22-14-8-15-23-32)33-24-16-9-17-25-33/h6-25,29,34-35H,26-28H2,1-5H3,(H,41,45)(H,43,44)/t34-,35+/m1/s1 |
| InChIKey | IIYOGHBULPNXOV-GPOMZPHUSA-N |
| XLogP | 8.35 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.88 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|