C18H17F17N2O5 — CID 167024067
methyl 2-[[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoyl]amino]acetate (PubChem CID 167024067) has the molecular formula C18H17F17N2O5 and a molecular weight of 664.31 g/mol. Its IUPAC name is methyl 2-[[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoyl]amino]acetate.
| Compound Name | methyl 2-[[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoyl]amino]acetate |
|---|---|
| PubChem CID | 167024067 |
| Molecular Formula | C18H17F17N2O5 |
| Molecular Weight | 664.31 g/mol |
| Exact Mass | 664.09 |
| IUPAC Name | methyl 2-[[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]decanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C(NC(=O)OC(C)(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H17F17N2O5/c1-10(2,3)42-9(40)37-7(8(39)36-5-6(38)41-4)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)35/h7H,5H2,1-4H3,(H,36,39)(H,37,40) |
| InChIKey | ISWMKXWDNMDBRO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.31 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|