C24H33N2O3PS — CID 132573915
tert-butyl N-[(2S)-1-[[(1R)-1-diphenylphosphinothioyl-2-methylpropyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 132573915) has the molecular formula C24H33N2O3PS and a molecular weight of 460.58 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(1R)-1-diphenylphosphinothioyl-2-methylpropyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(1R)-1-diphenylphosphinothioyl-2-methylpropyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 132573915 |
| Molecular Formula | C24H33N2O3PS |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(1R)-1-diphenylphosphinothioyl-2-methylpropyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C)NC(=O)OC(C)(C)C)P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33N2O3PS/c1-17(2)22(26-21(27)18(3)25-23(28)29-24(4,5)6)30(31,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-18,22H,1-6H3,(H,25,28)(H,26,27)/t18-,22+/m0/s1 |
| InChIKey | MCSBXCGVWPOBHA-PGRDOPGGSA-N |
| XLogP | 4.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|