C11H12Cl3NO3 — CID 842026
methyl N-[(1S)-2,2,2-trichloro-1-methoxy-1-phenylethyl]carbamate (PubChem CID 842026) has the molecular formula C11H12Cl3NO3 and a molecular weight of 312.58 g/mol. Its IUPAC name is methyl N-[(1S)-2,2,2-trichloro-1-methoxy-1-phenylethyl]carbamate.
| Compound Name | methyl N-[(1S)-2,2,2-trichloro-1-methoxy-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 842026 |
| Molecular Formula | C11H12Cl3NO3 |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | methyl N-[(1S)-2,2,2-trichloro-1-methoxy-1-phenylethyl]carbamate |
| SMILES | COC(=O)N[C@](OC)(c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H12Cl3NO3/c1-17-9(16)15-10(18-2,11(12,13)14)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | HYFMYMWIRXPWQS-JTQLQIEISA-N |
| XLogP | 3.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|