C21H34Cl2N2O2-2 — CID 46863733
1-(4-cyclohexylphenoxy)-3-(4-ethylpiperazin-1-yl)propan-2-ol dichloride (PubChem CID 46863733) has the molecular formula C21H34Cl2N2O2-2 and a molecular weight of 417.42 g/mol. Its IUPAC name is 1-(4-cyclohexylphenoxy)-3-(4-ethylpiperazin-1-yl)propan-2-ol dichloride.
| Compound Name | 1-(4-cyclohexylphenoxy)-3-(4-ethylpiperazin-1-yl)propan-2-ol dichloride |
|---|---|
| PubChem CID | 46863733 |
| Molecular Formula | C21H34Cl2N2O2-2 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-(4-cyclohexylphenoxy)-3-(4-ethylpiperazin-1-yl)propan-2-ol dichloride |
| SMILES | CCN1CCN(CC(O)COc2ccc(C3CCCCC3)cc2)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C21H34N2O2.2ClH/c1-2-22-12-14-23(15-13-22)16-20(24)17-25-21-10-8-19(9-11-21)18-6-4-3-5-7-18;;/h8-11,18,20,24H,2-7,12-17H2,1H3;2*1H/p-2 |
| InChIKey | TXUKSXFKXPTOAW-UHFFFAOYSA-L |
| XLogP | -2.88 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |