C21H36Cl2N2O3 — CID 44787153
1-(4-cyclohexylphenoxy)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol;dihydrochloride (PubChem CID 44787153) has the molecular formula C21H36Cl2N2O3 and a molecular weight of 435.44 g/mol. Its IUPAC name is 1-(4-cyclohexylphenoxy)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol;dihydrochloride.
| Compound Name | 1-(4-cyclohexylphenoxy)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 44787153 |
| Molecular Formula | C21H36Cl2N2O3 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-(4-cyclohexylphenoxy)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol;dihydrochloride |
| SMILES | Cl.Cl.OCCN1CCN(CC(O)COc2ccc(C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H34N2O3.2ClH/c24-15-14-22-10-12-23(13-11-22)16-20(25)17-26-21-8-6-19(7-9-21)18-4-2-1-3-5-18;;/h6-9,18,20,24-25H,1-5,10-17H2;2*1H |
| InChIKey | ULVMUFTXUGJQFW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |