C24H32ClNO4 — CID 19988320
[4-(2-chloro-3-methylbutanoyl)oxyphenyl] 4-cyano-4-(2-methylbutyl)cyclohexane-1-carboxylate (PubChem CID 19988320) has the molecular formula C24H32ClNO4 and a molecular weight of 433.98 g/mol. Its IUPAC name is [4-(2-chloro-3-methylbutanoyl)oxyphenyl] 4-cyano-4-(2-methylbutyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(2-chloro-3-methylbutanoyl)oxyphenyl] 4-cyano-4-(2-methylbutyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 19988320 |
| Molecular Formula | C24H32ClNO4 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [4-(2-chloro-3-methylbutanoyl)oxyphenyl] 4-cyano-4-(2-methylbutyl)cyclohexane-1-carboxylate |
| SMILES | CCC(C)CC1(C#N)CCC(C(=O)Oc2ccc(OC(=O)C(Cl)C(C)C)cc2)CC1 |
| InChI | InChI=1S/C24H32ClNO4/c1-5-17(4)14-24(15-26)12-10-18(11-13-24)22(27)29-19-6-8-20(9-7-19)30-23(28)21(25)16(2)3/h6-9,16-18,21H,5,10-14H2,1-4H3 |
| InChIKey | OMPPJYVPKJDHMY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|