C28H38N2O4 — CID 59978303
[4-(5-octylpyrimidin-2-yl)phenyl] (2S)-4-butyl-2-methyl-5-oxooxolane-2-carboxylate (PubChem CID 59978303) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is [4-(5-octylpyrimidin-2-yl)phenyl] (2S)-4-butyl-2-methyl-5-oxooxolane-2-carboxylate.
| Compound Name | [4-(5-octylpyrimidin-2-yl)phenyl] (2S)-4-butyl-2-methyl-5-oxooxolane-2-carboxylate |
|---|---|
| PubChem CID | 59978303 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | [4-(5-octylpyrimidin-2-yl)phenyl] (2S)-4-butyl-2-methyl-5-oxooxolane-2-carboxylate |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OC(=O)[C@]3(C)CC(CCCC)C(=O)O3)cc2)nc1 |
| InChI | InChI=1S/C28H38N2O4/c1-4-6-8-9-10-11-12-21-19-29-25(30-20-21)22-14-16-24(17-15-22)33-27(32)28(3)18-23(13-7-5-2)26(31)34-28/h14-17,19-20,23H,4-13,18H2,1-3H3/t23?,28-/m0/s1 |
| InChIKey | OUHDVIUKNDZFLV-WOKNPCPGSA-N |
| XLogP | 6.46 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|