C24H34N2O3 — CID 14744812
5-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]phenyl]-2-octylpyrimidine (PubChem CID 14744812) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 5-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]phenyl]-2-octylpyrimidine.
| Compound Name | 5-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]phenyl]-2-octylpyrimidine |
|---|---|
| PubChem CID | 14744812 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 5-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]phenyl]-2-octylpyrimidine |
| SMILES | CCCCCCCCc1ncc(-c2ccc(OCC3COC(C)(C)O3)cc2)cn1 |
| InChI | InChI=1S/C24H34N2O3/c1-4-5-6-7-8-9-10-23-25-15-20(16-26-23)19-11-13-21(14-12-19)27-17-22-18-28-24(2,3)29-22/h11-16,22H,4-10,17-18H2,1-3H3 |
| InChIKey | ZQXJJOAHRXPNOT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|