C24H34N2O4 — CID 14744809
5-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-2-octoxypyrimidine (PubChem CID 14744809) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 5-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-2-octoxypyrimidine.
| Compound Name | 5-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-2-octoxypyrimidine |
|---|---|
| PubChem CID | 14744809 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 5-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-2-octoxypyrimidine |
| SMILES | CCCCCCCCOc1ncc(-c2ccc(OC[C@H]3COC(C)(C)O3)cc2)cn1 |
| InChI | InChI=1S/C24H34N2O4/c1-4-5-6-7-8-9-14-27-23-25-15-20(16-26-23)19-10-12-21(13-11-19)28-17-22-18-29-24(2,3)30-22/h10-13,15-16,22H,4-9,14,17-18H2,1-3H3/t22-/m0/s1 |
| InChIKey | VQCHBCHQJTVLEG-QFIPXVFZSA-N |
| XLogP | 5.41 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|