C24H31BrO4 — CID 67029043
4-[[4-[3-[4-(3-bromopropyl)phenoxy]propyl]phenoxy]methyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 67029043) has the molecular formula C24H31BrO4 and a molecular weight of 463.41 g/mol. Its IUPAC name is 4-[[4-[3-[4-(3-bromopropyl)phenoxy]propyl]phenoxy]methyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[[4-[3-[4-(3-bromopropyl)phenoxy]propyl]phenoxy]methyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 67029043 |
| Molecular Formula | C24H31BrO4 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 4-[[4-[3-[4-(3-bromopropyl)phenoxy]propyl]phenoxy]methyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(COc2ccc(CCCOc3ccc(CCCBr)cc3)cc2)O1 |
| InChI | InChI=1S/C24H31BrO4/c1-24(2)28-18-23(29-24)17-27-22-13-9-20(10-14-22)6-4-16-26-21-11-7-19(8-12-21)5-3-15-25/h7-14,23H,3-6,15-18H2,1-2H3 |
| InChIKey | CQFBPSCILVFWJG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|