C13H18N2O4 — CID 123686862
4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 123686862) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 123686862 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | CC1(C)OC[C@@H](COc2ccc(C(N)=NO)cc2)O1 |
| InChI | InChI=1S/C13H18N2O4/c1-13(2)18-8-11(19-13)7-17-10-5-3-9(4-6-10)12(14)15-16/h3-6,11,16H,7-8H2,1-2H3,(H2,14,15)/t11-/m1/s1 |
| InChIKey | ARQOEANQFOABPZ-LLVKDONJSA-N |
| XLogP | 1.31 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|