C22H26O6 — CID 67087183
4-[3-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]propoxy]benzoic acid (PubChem CID 67087183) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is 4-[3-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]propoxy]benzoic acid.
| Compound Name | 4-[3-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 67087183 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-[3-[4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]phenyl]propoxy]benzoic acid |
| SMILES | CC1(C)OC[C@@H](COc2ccc(CCCOc3ccc(C(=O)O)cc3)cc2)O1 |
| InChI | InChI=1S/C22H26O6/c1-22(2)27-15-20(28-22)14-26-19-9-5-16(6-10-19)4-3-13-25-18-11-7-17(8-12-18)21(23)24/h5-12,20H,3-4,13-15H2,1-2H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | MEOKCMUMADEVLL-HXUWFJFHSA-N |
| XLogP | 3.93 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|