C14H20N2O4 — CID 87478601
4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-N'-hydroxy-2-methylbenzenecarboximidamide (PubChem CID 87478601) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-N'-hydroxy-2-methylbenzenecarboximidamide.
| Compound Name | 4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-N'-hydroxy-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 87478601 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-N'-hydroxy-2-methylbenzenecarboximidamide |
| SMILES | Cc1cc(OC[C@@H]2COC(C)(C)O2)ccc1/C(N)=N/O |
| InChI | InChI=1S/C14H20N2O4/c1-9-6-10(4-5-12(9)13(15)16-17)18-7-11-8-19-14(2,3)20-11/h4-6,11,17H,7-8H2,1-3H3,(H2,15,16)/t11-/m1/s1 |
| InChIKey | RXJMDWGZWOFPJR-LLVKDONJSA-N |
| XLogP | 1.62 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|