C24H34N2O3 — CID 150546163
5-[4-[(4S)-4-methoxy-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-2-octylpyrimidine (PubChem CID 150546163) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 5-[4-[(4S)-4-methoxy-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-2-octylpyrimidine.
| Compound Name | 5-[4-[(4S)-4-methoxy-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-2-octylpyrimidine |
|---|---|
| PubChem CID | 150546163 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 5-[4-[(4S)-4-methoxy-2,2-dimethyl-1,3-dioxolan-4-yl]phenyl]-2-octylpyrimidine |
| SMILES | CCCCCCCCc1ncc(-c2ccc([C@@]3(OC)COC(C)(C)O3)cc2)cn1 |
| InChI | InChI=1S/C24H34N2O3/c1-5-6-7-8-9-10-11-22-25-16-20(17-26-22)19-12-14-21(15-13-19)24(27-4)18-28-23(2,3)29-24/h12-17H,5-11,18H2,1-4H3/t24-/m1/s1 |
| InChIKey | IGXKOAWUVZSRTR-XMMPIXPASA-N |
| XLogP | 5.63 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|