C28H32N2O5 — CID 70353571
[(4R)-4-[4-[5-(4-hexylphenyl)pyrimidin-2-yl]phenyl]-2,2-dimethyl-1,3-dioxolan-4-yl] hydrogen carbonate (PubChem CID 70353571) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is [(4R)-4-[4-[5-(4-hexylphenyl)pyrimidin-2-yl]phenyl]-2,2-dimethyl-1,3-dioxolan-4-yl] hydrogen carbonate.
| Compound Name | [(4R)-4-[4-[5-(4-hexylphenyl)pyrimidin-2-yl]phenyl]-2,2-dimethyl-1,3-dioxolan-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70353571 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [(4R)-4-[4-[5-(4-hexylphenyl)pyrimidin-2-yl]phenyl]-2,2-dimethyl-1,3-dioxolan-4-yl] hydrogen carbonate |
| SMILES | CCCCCCc1ccc(-c2cnc(-c3ccc([C@@]4(OC(=O)O)COC(C)(C)O4)cc3)nc2)cc1 |
| InChI | InChI=1S/C28H32N2O5/c1-4-5-6-7-8-20-9-11-21(12-10-20)23-17-29-25(30-18-23)22-13-15-24(16-14-22)28(34-26(31)32)19-33-27(2,3)35-28/h9-18H,4-8,19H2,1-3H3,(H,31,32)/t28-/m1/s1 |
| InChIKey | DMZDCSYVUQOTHZ-MUUNZHRXSA-N |
| XLogP | 6.56 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|