C33H43FN2O2 — CID 139623279
[4-[2-(4-decylphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylhexanoate (PubChem CID 139623279) has the molecular formula C33H43FN2O2 and a molecular weight of 518.72 g/mol. Its IUPAC name is [4-[2-(4-decylphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylhexanoate.
| Compound Name | [4-[2-(4-decylphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylhexanoate |
|---|---|
| PubChem CID | 139623279 |
| Molecular Formula | C33H43FN2O2 |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | [4-[2-(4-decylphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylhexanoate |
| SMILES | CCCCCCCCCCc1ccc(-c2ncc(-c3ccc(OC(=O)C(C)(F)CCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C33H43FN2O2/c1-4-6-8-9-10-11-12-13-14-26-15-17-28(18-16-26)31-35-24-29(25-36-31)27-19-21-30(22-20-27)38-32(37)33(3,34)23-7-5-2/h15-22,24-25H,4-14,23H2,1-3H3 |
| InChIKey | CVKCOGVUPUWNED-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|