C30H37FN2O2 — CID 139639845
[4-[2-(5-butylpyrimidin-2-yl)phenyl]phenyl] 2-fluoro-2-methylnonanoate (PubChem CID 139639845) has the molecular formula C30H37FN2O2 and a molecular weight of 476.64 g/mol. Its IUPAC name is [4-[2-(5-butylpyrimidin-2-yl)phenyl]phenyl] 2-fluoro-2-methylnonanoate.
| Compound Name | [4-[2-(5-butylpyrimidin-2-yl)phenyl]phenyl] 2-fluoro-2-methylnonanoate |
|---|---|
| PubChem CID | 139639845 |
| Molecular Formula | C30H37FN2O2 |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | [4-[2-(5-butylpyrimidin-2-yl)phenyl]phenyl] 2-fluoro-2-methylnonanoate |
| SMILES | CCCCCCCC(C)(F)C(=O)Oc1ccc(-c2ccccc2-c2ncc(CCCC)cn2)cc1 |
| InChI | InChI=1S/C30H37FN2O2/c1-4-6-8-9-12-20-30(3,31)29(34)35-25-18-16-24(17-19-25)26-14-10-11-15-27(26)28-32-21-23(22-33-28)13-7-5-2/h10-11,14-19,21-22H,4-9,12-13,20H2,1-3H3 |
| InChIKey | CCYDDDWCFBSSSE-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|