C32H40FNO2 — CID 139639854
[4-[2-(5-propyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylundecanoate (PubChem CID 139639854) has the molecular formula C32H40FNO2 and a molecular weight of 489.68 g/mol. Its IUPAC name is [4-[2-(5-propyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylundecanoate.
| Compound Name | [4-[2-(5-propyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylundecanoate |
|---|---|
| PubChem CID | 139639854 |
| Molecular Formula | C32H40FNO2 |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | [4-[2-(5-propyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylundecanoate |
| SMILES | CCCCCCCCCC(C)(F)C(=O)Oc1ccc(-c2ccccc2-c2ccc(CCC)cn2)cc1 |
| InChI | InChI=1S/C32H40FNO2/c1-4-6-7-8-9-10-13-23-32(3,33)31(35)36-27-20-18-26(19-21-27)28-15-11-12-16-29(28)30-22-17-25(14-5-2)24-34-30/h11-12,15-22,24H,4-10,13-14,23H2,1-3H3 |
| InChIKey | NNHBEFPOKZYVQN-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|