C32H40F2N2O2 — CID 139811888
[4-[2-[4-[(3S)-3-fluorobutyl]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methylundecanoate (PubChem CID 139811888) has the molecular formula C32H40F2N2O2 and a molecular weight of 522.68 g/mol. Its IUPAC name is [4-[2-[4-[(3S)-3-fluorobutyl]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methylundecanoate.
| Compound Name | [4-[2-[4-[(3S)-3-fluorobutyl]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methylundecanoate |
|---|---|
| PubChem CID | 139811888 |
| Molecular Formula | C32H40F2N2O2 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | [4-[2-[4-[(3S)-3-fluorobutyl]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methylundecanoate |
| SMILES | CCCCCCCCC[C@](C)(F)C(=O)Oc1ccc(-c2cnc(-c3ccc(CC[C@H](C)F)cc3)nc2)cc1 |
| InChI | InChI=1S/C32H40F2N2O2/c1-4-5-6-7-8-9-10-21-32(3,34)31(37)38-29-19-17-26(18-20-29)28-22-35-30(36-23-28)27-15-13-25(14-16-27)12-11-24(2)33/h13-20,22-24H,4-12,21H2,1-3H3/t24-,32-/m0/s1 |
| InChIKey | IWAORCTZUWTCDH-BNHRFMORSA-N |
| XLogP | 8.88 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|