C26H29FN2O3 — CID 19762061
[4-[2-(4-butoxyphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylpentanoate (PubChem CID 19762061) has the molecular formula C26H29FN2O3 and a molecular weight of 436.53 g/mol. Its IUPAC name is [4-[2-(4-butoxyphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylpentanoate.
| Compound Name | [4-[2-(4-butoxyphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylpentanoate |
|---|---|
| PubChem CID | 19762061 |
| Molecular Formula | C26H29FN2O3 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [4-[2-(4-butoxyphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylpentanoate |
| SMILES | CCCCOc1ccc(-c2ncc(-c3ccc(OC(=O)C(C)(F)CCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C26H29FN2O3/c1-4-6-16-31-22-11-9-20(10-12-22)24-28-17-21(18-29-24)19-7-13-23(14-8-19)32-25(30)26(3,27)15-5-2/h7-14,17-18H,4-6,15-16H2,1-3H3 |
| InChIKey | NSTXHMNOAAGMFX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|