C30H36F2N2O3 — CID 102047449
[4-[2-(2-fluoro-4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylheptanoate (PubChem CID 102047449) has the molecular formula C30H36F2N2O3 and a molecular weight of 510.63 g/mol. Its IUPAC name is [4-[2-(2-fluoro-4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylheptanoate.
| Compound Name | [4-[2-(2-fluoro-4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylheptanoate |
|---|---|
| PubChem CID | 102047449 |
| Molecular Formula | C30H36F2N2O3 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | [4-[2-(2-fluoro-4-hexoxyphenyl)pyrimidin-5-yl]phenyl] 2-fluoro-2-methylheptanoate |
| SMILES | CCCCCCOc1ccc(-c2ncc(-c3ccc(OC(=O)C(C)(F)CCCCC)cc3)cn2)c(F)c1 |
| InChI | InChI=1S/C30H36F2N2O3/c1-4-6-8-10-18-36-25-15-16-26(27(31)19-25)28-33-20-23(21-34-28)22-11-13-24(14-12-22)37-29(35)30(3,32)17-9-7-5-2/h11-16,19-21H,4-10,17-18H2,1-3H3 |
| InChIKey | WBIZUCPZDUWRAK-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|