C34H44F2N2O3 — CID 102594769
[4-[2-[4-[(2R)-2-fluoroheptoxy]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methyldecanoate (PubChem CID 102594769) has the molecular formula C34H44F2N2O3 and a molecular weight of 566.73 g/mol. Its IUPAC name is [4-[2-[4-[(2R)-2-fluoroheptoxy]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methyldecanoate.
| Compound Name | [4-[2-[4-[(2R)-2-fluoroheptoxy]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methyldecanoate |
|---|---|
| PubChem CID | 102594769 |
| Molecular Formula | C34H44F2N2O3 |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | [4-[2-[4-[(2R)-2-fluoroheptoxy]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methyldecanoate |
| SMILES | CCCCCCCC[C@](C)(F)C(=O)Oc1ccc(-c2cnc(-c3ccc(OC[C@H](F)CCCCC)cc3)nc2)cc1 |
| InChI | InChI=1S/C34H44F2N2O3/c1-4-6-8-9-10-12-22-34(3,36)33(39)41-31-20-14-26(15-21-31)28-23-37-32(38-24-28)27-16-18-30(19-17-27)40-25-29(35)13-11-7-5-2/h14-21,23-24,29H,4-13,22,25H2,1-3H3/t29-,34+/m1/s1 |
| InChIKey | MNTCOKRMFNOQSE-SJHOIFEDSA-N |
| XLogP | 9.49 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|