C36H48F2N2O3 — CID 139777787
[4-[2-[4-[(7S)-7-fluorooctoxy]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methylundecanoate (PubChem CID 139777787) has the molecular formula C36H48F2N2O3 and a molecular weight of 594.79 g/mol. Its IUPAC name is [4-[2-[4-[(7S)-7-fluorooctoxy]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methylundecanoate.
| Compound Name | [4-[2-[4-[(7S)-7-fluorooctoxy]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methylundecanoate |
|---|---|
| PubChem CID | 139777787 |
| Molecular Formula | C36H48F2N2O3 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.36 |
| IUPAC Name | [4-[2-[4-[(7S)-7-fluorooctoxy]phenyl]pyrimidin-5-yl]phenyl] (2S)-2-fluoro-2-methylundecanoate |
| SMILES | CCCCCCCCC[C@](C)(F)C(=O)Oc1ccc(-c2cnc(-c3ccc(OCCCCCC[C@H](C)F)cc3)nc2)cc1 |
| InChI | InChI=1S/C36H48F2N2O3/c1-4-5-6-7-8-10-13-24-36(3,38)35(41)43-33-22-16-29(17-23-33)31-26-39-34(40-27-31)30-18-20-32(21-19-30)42-25-14-11-9-12-15-28(2)37/h16-23,26-28H,4-15,24-25H2,1-3H3/t28-,36-/m0/s1 |
| InChIKey | CCKRBNCXICJUJU-GOOPYHEFSA-N |
| XLogP | 10.27 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|