C35H45F3N2O3 — CID 139648073
[4-[2-[2-(2,3-difluorodecan-4-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methyloctanoate (PubChem CID 139648073) has the molecular formula C35H45F3N2O3 and a molecular weight of 598.75 g/mol. Its IUPAC name is [4-[2-[2-(2,3-difluorodecan-4-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methyloctanoate.
| Compound Name | [4-[2-[2-(2,3-difluorodecan-4-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methyloctanoate |
|---|---|
| PubChem CID | 139648073 |
| Molecular Formula | C35H45F3N2O3 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | [4-[2-[2-(2,3-difluorodecan-4-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methyloctanoate |
| SMILES | CCCCCCC(Oc1ccccc1-c1ncc(-c2ccc(OC(=O)C(C)(F)CCCCCC)cc2)cn1)C(F)C(C)F |
| InChI | InChI=1S/C35H45F3N2O3/c1-5-7-9-11-17-31(32(37)25(3)36)43-30-16-13-12-15-29(30)33-39-23-27(24-40-33)26-18-20-28(21-19-26)42-34(41)35(4,38)22-14-10-8-6-2/h12-13,15-16,18-21,23-25,31-32H,5-11,14,17,22H2,1-4H3 |
| InChIKey | RQNGUEOEBGAOPU-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|