C32H39F3N2O3 — CID 139648016
[4-[2-[2-(4,5-difluorohexan-3-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methylnonanoate (PubChem CID 139648016) has the molecular formula C32H39F3N2O3 and a molecular weight of 556.67 g/mol. Its IUPAC name is [4-[2-[2-(4,5-difluorohexan-3-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methylnonanoate.
| Compound Name | [4-[2-[2-(4,5-difluorohexan-3-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methylnonanoate |
|---|---|
| PubChem CID | 139648016 |
| Molecular Formula | C32H39F3N2O3 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | [4-[2-[2-(4,5-difluorohexan-3-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methylnonanoate |
| SMILES | CCCCCCCC(C)(F)C(=O)Oc1ccc(-c2cnc(-c3ccccc3OC(CC)C(F)C(C)F)nc2)cc1 |
| InChI | InChI=1S/C32H39F3N2O3/c1-5-7-8-9-12-19-32(4,35)31(38)39-25-17-15-23(16-18-25)24-20-36-30(37-21-24)26-13-10-11-14-28(26)40-27(6-2)29(34)22(3)33/h10-11,13-18,20-22,27,29H,5-9,12,19H2,1-4H3 |
| InChIKey | FROOXTOXLQUCSK-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|