C29H33F3N2O3 — CID 139648047
[4-[2-[2-(2,3-difluorooctan-4-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methylbutanoate (PubChem CID 139648047) has the molecular formula C29H33F3N2O3 and a molecular weight of 514.59 g/mol. Its IUPAC name is [4-[2-[2-(2,3-difluorooctan-4-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methylbutanoate.
| Compound Name | [4-[2-[2-(2,3-difluorooctan-4-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methylbutanoate |
|---|---|
| PubChem CID | 139648047 |
| Molecular Formula | C29H33F3N2O3 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | [4-[2-[2-(2,3-difluorooctan-4-yloxy)phenyl]pyrimidin-5-yl]phenyl] 2-fluoro-2-methylbutanoate |
| SMILES | CCCCC(Oc1ccccc1-c1ncc(-c2ccc(OC(=O)C(C)(F)CC)cc2)cn1)C(F)C(C)F |
| InChI | InChI=1S/C29H33F3N2O3/c1-5-7-11-25(26(31)19(3)30)37-24-12-9-8-10-23(24)27-33-17-21(18-34-27)20-13-15-22(16-14-20)36-28(35)29(4,32)6-2/h8-10,12-19,25-26H,5-7,11H2,1-4H3 |
| InChIKey | KPNPTXNTAHLTQJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|