C28H32FNO2 — CID 139639850
[4-[2-(5-pentyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylpentanoate (PubChem CID 139639850) has the molecular formula C28H32FNO2 and a molecular weight of 433.57 g/mol. Its IUPAC name is [4-[2-(5-pentyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylpentanoate.
| Compound Name | [4-[2-(5-pentyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylpentanoate |
|---|---|
| PubChem CID | 139639850 |
| Molecular Formula | C28H32FNO2 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | [4-[2-(5-pentyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylpentanoate |
| SMILES | CCCCCc1ccc(-c2ccccc2-c2ccc(OC(=O)C(C)(F)CCC)cc2)nc1 |
| InChI | InChI=1S/C28H32FNO2/c1-4-6-7-10-21-13-18-26(30-20-21)25-12-9-8-11-24(25)22-14-16-23(17-15-22)32-27(31)28(3,29)19-5-2/h8-9,11-18,20H,4-7,10,19H2,1-3H3 |
| InChIKey | KHSFCAPBBPMDRA-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|