C34H44FNO2 — CID 139639817
[4-[2-(5-heptyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylnonanoate (PubChem CID 139639817) has the molecular formula C34H44FNO2 and a molecular weight of 517.73 g/mol. Its IUPAC name is [4-[2-(5-heptyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylnonanoate.
| Compound Name | [4-[2-(5-heptyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylnonanoate |
|---|---|
| PubChem CID | 139639817 |
| Molecular Formula | C34H44FNO2 |
| Molecular Weight | 517.73 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | [4-[2-(5-heptyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylnonanoate |
| SMILES | CCCCCCCc1ccc(-c2ccccc2-c2ccc(OC(=O)C(C)(F)CCCCCCC)cc2)nc1 |
| InChI | InChI=1S/C34H44FNO2/c1-4-6-8-10-12-16-27-19-24-32(36-26-27)31-18-14-13-17-30(31)28-20-22-29(23-21-28)38-33(37)34(3,35)25-15-11-9-7-5-2/h13-14,17-24,26H,4-12,15-16,25H2,1-3H3 |
| InChIKey | BEBHCCILGIILOZ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.73 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|