C35H46FNO2 — CID 139639892
[4-[2-(5-octyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylnonanoate (PubChem CID 139639892) has the molecular formula C35H46FNO2 and a molecular weight of 531.76 g/mol. Its IUPAC name is [4-[2-(5-octyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylnonanoate.
| Compound Name | [4-[2-(5-octyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylnonanoate |
|---|---|
| PubChem CID | 139639892 |
| Molecular Formula | C35H46FNO2 |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 531.35 |
| IUPAC Name | [4-[2-(5-octyl-2-pyridinyl)phenyl]phenyl] 2-fluoro-2-methylnonanoate |
| SMILES | CCCCCCCCc1ccc(-c2ccccc2-c2ccc(OC(=O)C(C)(F)CCCCCCC)cc2)nc1 |
| InChI | InChI=1S/C35H46FNO2/c1-4-6-8-10-11-13-17-28-20-25-33(37-27-28)32-19-15-14-18-31(32)29-21-23-30(24-22-29)39-34(38)35(3,36)26-16-12-9-7-5-2/h14-15,18-25,27H,4-13,16-17,26H2,1-3H3 |
| InChIKey | FJPWZOGACAONGE-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|