C26H34N2O5 — CID 19013847
[2-(4-octoxyphenyl)pyrimidin-5-yl] 5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 19013847) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is [2-(4-octoxyphenyl)pyrimidin-5-yl] 5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | [2-(4-octoxyphenyl)pyrimidin-5-yl] 5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 19013847 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [2-(4-octoxyphenyl)pyrimidin-5-yl] 5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | C=CC1OC(C)(C)OC1C(=O)Oc1cnc(-c2ccc(OCCCCCCCC)cc2)nc1 |
| InChI | InChI=1S/C26H34N2O5/c1-5-7-8-9-10-11-16-30-20-14-12-19(13-15-20)24-27-17-21(18-28-24)31-25(29)23-22(6-2)32-26(3,4)33-23/h6,12-15,17-18,22-23H,2,5,7-11,16H2,1,3-4H3 |
| InChIKey | MQUDTRDGHXFZDG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|