C29H36O7 — CID 19013850
[4-(4-octoxybenzoyl)oxyphenyl] 5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 19013850) has the molecular formula C29H36O7 and a molecular weight of 496.60 g/mol. Its IUPAC name is [4-(4-octoxybenzoyl)oxyphenyl] 5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | [4-(4-octoxybenzoyl)oxyphenyl] 5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 19013850 |
| Molecular Formula | C29H36O7 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | [4-(4-octoxybenzoyl)oxyphenyl] 5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | C=CC1OC(C)(C)OC1C(=O)Oc1ccc(OC(=O)c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C29H36O7/c1-5-7-8-9-10-11-20-32-22-14-12-21(13-15-22)27(30)33-23-16-18-24(19-17-23)34-28(31)26-25(6-2)35-29(3,4)36-26/h6,12-19,25-26H,2,5,7-11,20H2,1,3-4H3 |
| InChIKey | QDHFGQMCVOUVMH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|