C30H45ClN2O3 — CID 67941444
[4-(2-octoxypyrimidin-5-yl)phenyl] (2S,3R)-3-chloro-2-methylundecanoate (PubChem CID 67941444) has the molecular formula C30H45ClN2O3 and a molecular weight of 517.15 g/mol. Its IUPAC name is [4-(2-octoxypyrimidin-5-yl)phenyl] (2S,3R)-3-chloro-2-methylundecanoate.
| Compound Name | [4-(2-octoxypyrimidin-5-yl)phenyl] (2S,3R)-3-chloro-2-methylundecanoate |
|---|---|
| PubChem CID | 67941444 |
| Molecular Formula | C30H45ClN2O3 |
| Molecular Weight | 517.15 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | [4-(2-octoxypyrimidin-5-yl)phenyl] (2S,3R)-3-chloro-2-methylundecanoate |
| SMILES | CCCCCCCCOc1ncc(-c2ccc(OC(=O)[C@H](C)[C@H](Cl)CCCCCCCC)cc2)cn1 |
| InChI | InChI=1S/C30H45ClN2O3/c1-4-6-8-10-12-14-16-28(31)24(3)29(34)36-27-19-17-25(18-20-27)26-22-32-30(33-23-26)35-21-15-13-11-9-7-5-2/h17-20,22-24,28H,4-16,21H2,1-3H3/t24-,28-/m1/s1 |
| InChIKey | PUVQEGILRDKKDG-UFHPHHKVSA-N |
| XLogP | 8.78 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.15 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|