C29H43ClN2O2 — CID 67941418
[3-(5-nonylpyrazin-2-yl)phenyl] (2S,3R)-3-chloro-2-methylnonanoate (PubChem CID 67941418) has the molecular formula C29H43ClN2O2 and a molecular weight of 487.13 g/mol. Its IUPAC name is [3-(5-nonylpyrazin-2-yl)phenyl] (2S,3R)-3-chloro-2-methylnonanoate.
| Compound Name | [3-(5-nonylpyrazin-2-yl)phenyl] (2S,3R)-3-chloro-2-methylnonanoate |
|---|---|
| PubChem CID | 67941418 |
| Molecular Formula | C29H43ClN2O2 |
| Molecular Weight | 487.13 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | [3-(5-nonylpyrazin-2-yl)phenyl] (2S,3R)-3-chloro-2-methylnonanoate |
| SMILES | CCCCCCCCCc1cnc(-c2cccc(OC(=O)[C@H](C)[C@H](Cl)CCCCCC)c2)cn1 |
| InChI | InChI=1S/C29H43ClN2O2/c1-4-6-8-10-11-12-13-17-25-21-32-28(22-31-25)24-16-15-18-26(20-24)34-29(33)23(3)27(30)19-14-9-7-5-2/h15-16,18,20-23,27H,4-14,17,19H2,1-3H3/t23-,27-/m1/s1 |
| InChIKey | KHBYRRUWYTXBPB-YIXXDRMTSA-N |
| XLogP | 8.56 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.13 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|