C23H31ClN2O2 — CID 56981979
2-chloro-5-[4-(5-heptylpyrazin-2-yl)phenyl]-3-methylpentanoic acid (PubChem CID 56981979) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is 2-chloro-5-[4-(5-heptylpyrazin-2-yl)phenyl]-3-methylpentanoic acid.
| Compound Name | 2-chloro-5-[4-(5-heptylpyrazin-2-yl)phenyl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 56981979 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-chloro-5-[4-(5-heptylpyrazin-2-yl)phenyl]-3-methylpentanoic acid |
| SMILES | CCCCCCCc1cnc(-c2ccc(CCC(C)C(Cl)C(=O)O)cc2)cn1 |
| InChI | InChI=1S/C23H31ClN2O2/c1-3-4-5-6-7-8-20-15-26-21(16-25-20)19-13-11-18(12-14-19)10-9-17(2)22(24)23(27)28/h11-17,22H,3-10H2,1-2H3,(H,27,28) |
| InChIKey | PSGJWLPUCARXPP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|