C47H64Br2N4O4 — CID 88646955
[4-(5-heptylpyrazin-2-yl)phenyl] 3-bromo-2-methylpentanoate;[4-(5-octylpyrazin-2-yl)phenyl] 3-bromo-2-methylpentanoate (PubChem CID 88646955) has the molecular formula C47H64Br2N4O4 and a molecular weight of 908.86 g/mol. Its IUPAC name is [4-(5-heptylpyrazin-2-yl)phenyl] 3-bromo-2-methylpentanoate;[4-(5-octylpyrazin-2-yl)phenyl] 3-bromo-2-methylpentanoate.
| Compound Name | [4-(5-heptylpyrazin-2-yl)phenyl] 3-bromo-2-methylpentanoate;[4-(5-octylpyrazin-2-yl)phenyl] 3-bromo-2-methylpentanoate |
|---|---|
| PubChem CID | 88646955 |
| Molecular Formula | C47H64Br2N4O4 |
| Molecular Weight | 908.86 g/mol |
| Exact Mass | 906.33 |
| IUPAC Name | [4-(5-heptylpyrazin-2-yl)phenyl] 3-bromo-2-methylpentanoate;[4-(5-octylpyrazin-2-yl)phenyl] 3-bromo-2-methylpentanoate |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OC(=O)C(C)C(Br)CC)cc2)cn1.CCCCCCCc1cnc(-c2ccc(OC(=O)C(C)C(Br)CC)cc2)cn1 |
| InChI | InChI=1S/C24H33BrN2O2.C23H31BrN2O2/c1-4-6-7-8-9-10-11-20-16-27-23(17-26-20)19-12-14-21(15-13-19)29-24(28)18(3)22(25)5-2;1-4-6-7-8-9-10-19-15-26-22(16-25-19)18-11-13-20(14-12-18)28-23(27)17(3)21(24)5-2/h12-18,22H,4-11H2,1-3H3;11-17,21H,4-10H2,1-3H3 |
| InChIKey | PNUFHYQGPLRIMG-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.86 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|