C22H24F4O — CID 143115064
1-ethoxy-2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]-3-(trifluoromethyl)benzene (PubChem CID 143115064) has the molecular formula C22H24F4O and a molecular weight of 380.43 g/mol. Its IUPAC name is 1-ethoxy-2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-ethoxy-2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 143115064 |
| Molecular Formula | C22H24F4O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-ethoxy-2-fluoro-4-[4-(4-methylcyclohexyl)phenyl]-3-(trifluoromethyl)benzene |
| SMILES | CCOc1ccc(-c2ccc(C3CCC(C)CC3)cc2)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C22H24F4O/c1-3-27-19-13-12-18(20(21(19)23)22(24,25)26)17-10-8-16(9-11-17)15-6-4-14(2)5-7-15/h8-15H,3-7H2,1-2H3 |
| InChIKey | JPSRFOIIQLITLZ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |