C21H22F2O2 — CID 20683383
(4-methylphenyl) 2,3-difluoro-4-(4-methylcyclohexyl)benzoate (PubChem CID 20683383) has the molecular formula C21H22F2O2 and a molecular weight of 344.40 g/mol. Its IUPAC name is (4-methylphenyl) 2,3-difluoro-4-(4-methylcyclohexyl)benzoate.
| Compound Name | (4-methylphenyl) 2,3-difluoro-4-(4-methylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 20683383 |
| Molecular Formula | C21H22F2O2 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (4-methylphenyl) 2,3-difluoro-4-(4-methylcyclohexyl)benzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(C3CCC(C)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H22F2O2/c1-13-3-7-15(8-4-13)17-11-12-18(20(23)19(17)22)21(24)25-16-9-5-14(2)6-10-16/h5-6,9-13,15H,3-4,7-8H2,1-2H3 |
| InChIKey | LXBLKBBIZWMFTL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|