C27H33F3O2 — CID 162552470
1-[2-hydroxy-4-[4-(4-pentan-2-ylcyclohexyl)phenyl]-3-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 162552470) has the molecular formula C27H33F3O2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 1-[2-hydroxy-4-[4-(4-pentan-2-ylcyclohexyl)phenyl]-3-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 1-[2-hydroxy-4-[4-(4-pentan-2-ylcyclohexyl)phenyl]-3-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 162552470 |
| Molecular Formula | C27H33F3O2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-[2-hydroxy-4-[4-(4-pentan-2-ylcyclohexyl)phenyl]-3-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | CCCC(C)C1CCC(c2ccc(-c3ccc(C(=O)CC)c(O)c3C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C27H33F3O2/c1-4-6-17(3)18-7-9-19(10-8-18)20-11-13-21(14-12-20)22-15-16-23(24(31)5-2)26(32)25(22)27(28,29)30/h11-19,32H,4-10H2,1-3H3 |
| InChIKey | OTPJTIPWBDRQBL-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |