C31H40F2O2 — CID 162547851
4-[4-[difluoro-[4-[4-[(2S)-pentan-2-yl]cyclohexyl]phenyl]methoxy]phenyl]cyclohexane-1-carbaldehyde (PubChem CID 162547851) has the molecular formula C31H40F2O2 and a molecular weight of 482.66 g/mol. Its IUPAC name is 4-[4-[difluoro-[4-[4-[(2S)-pentan-2-yl]cyclohexyl]phenyl]methoxy]phenyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[4-[difluoro-[4-[4-[(2S)-pentan-2-yl]cyclohexyl]phenyl]methoxy]phenyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 162547851 |
| Molecular Formula | C31H40F2O2 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 4-[4-[difluoro-[4-[4-[(2S)-pentan-2-yl]cyclohexyl]phenyl]methoxy]phenyl]cyclohexane-1-carbaldehyde |
| SMILES | CCC[C@H](C)C1CCC(c2ccc(C(F)(F)Oc3ccc(C4CCC(C=O)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H40F2O2/c1-3-4-22(2)24-9-11-26(12-10-24)27-13-17-29(18-14-27)31(32,33)35-30-19-15-28(16-20-30)25-7-5-23(21-34)6-8-25/h13-26H,3-12H2,1-2H3/t22-,23?,24?,25?,26?/m0/s1 |
| InChIKey | CGXCKENVVCMYCC-IQYYOCLFSA-N |
| XLogP | 9.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|