C27H30F4O — CID 163574682
4-[[4-[4-[(E)-2-cyclohexylethenyl]cyclohexyl]phenyl]-difluoromethoxy]-1,2-difluorobenzene (PubChem CID 163574682) has the molecular formula C27H30F4O and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-[[4-[4-[(E)-2-cyclohexylethenyl]cyclohexyl]phenyl]-difluoromethoxy]-1,2-difluorobenzene.
| Compound Name | 4-[[4-[4-[(E)-2-cyclohexylethenyl]cyclohexyl]phenyl]-difluoromethoxy]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 163574682 |
| Molecular Formula | C27H30F4O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 4-[[4-[4-[(E)-2-cyclohexylethenyl]cyclohexyl]phenyl]-difluoromethoxy]-1,2-difluorobenzene |
| SMILES | Fc1ccc(OC(F)(F)c2ccc(C3CCC(/C=C/C4CCCCC4)CC3)cc2)cc1F |
| InChI | InChI=1S/C27H30F4O/c28-25-17-16-24(18-26(25)29)32-27(30,31)23-14-12-22(13-15-23)21-10-8-20(9-11-21)7-6-19-4-2-1-3-5-19/h6-7,12-21H,1-5,8-11H2/b7-6+ |
| InChIKey | GCKRWXMPRAMDMB-VOTSOKGWSA-N |
| XLogP | 8.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|