C28H40F2O2 — CID 58942534
1-[3-(difluoromethyl)-2-hydroxy-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]butan-1-one (PubChem CID 58942534) has the molecular formula C28H40F2O2 and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-2-hydroxy-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]butan-1-one.
| Compound Name | 1-[3-(difluoromethyl)-2-hydroxy-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 58942534 |
| Molecular Formula | C28H40F2O2 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 1-[3-(difluoromethyl)-2-hydroxy-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]butan-1-one |
| SMILES | C/C=C/CCC1CCC(C2CCC(c3ccc(C(=O)CCC)c(O)c3C(F)F)CC2)CC1 |
| InChI | InChI=1S/C28H40F2O2/c1-3-5-6-8-19-9-11-20(12-10-19)21-13-15-22(16-14-21)23-17-18-24(25(31)7-4-2)27(32)26(23)28(29)30/h3,5,17-22,28,32H,4,6-16H2,1-2H3/b5-3+ |
| InChIKey | LAUACDDFBZUSCF-HWKANZROSA-N |
| XLogP | 8.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|