C28H30F4O2 — CID 70178836
2-fluoro-4-[4-(4-prop-2-enylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 70178836) has the molecular formula C28H30F4O2 and a molecular weight of 474.54 g/mol. Its IUPAC name is 2-fluoro-4-[4-(4-prop-2-enylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 2-fluoro-4-[4-(4-prop-2-enylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 70178836 |
| Molecular Formula | C28H30F4O2 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 2-fluoro-4-[4-(4-prop-2-enylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | C=CCC1CCC(C2CCC(c3ccc(C(=O)O)c(F)c3-c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H30F4O2/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)21-12-13-22(28(33)34)26(31)25(21)20-14-23(29)27(32)24(30)15-20/h2,12-19H,1,3-11H2,(H,33,34) |
| InChIKey | WSUFKDWOCOBLBW-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|