C25H25F5O2 — CID 18411020
2,6-difluoro-4-[4-[(E)-hex-3-enyl]cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 18411020) has the molecular formula C25H25F5O2 and a molecular weight of 452.46 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-[(E)-hex-3-enyl]cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 2,6-difluoro-4-[4-[(E)-hex-3-enyl]cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 18411020 |
| Molecular Formula | C25H25F5O2 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2,6-difluoro-4-[4-[(E)-hex-3-enyl]cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | CC/C=C/CCC1CCC(c2cc(F)c(C(=O)O)c(F)c2-c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C25H25F5O2/c1-2-3-4-5-6-14-7-9-15(10-8-14)17-13-18(26)22(25(31)32)24(30)21(17)16-11-19(27)23(29)20(28)12-16/h3-4,11-15H,2,5-10H2,1H3,(H,31,32)/b4-3+ |
| InChIKey | LKDFJYHEUZNQAS-ONEGZZNKSA-N |
| XLogP | 7.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|