C30H35F5O2 — CID 57001020
2,6-difluoro-4-[1-(4-pentylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 57001020) has the molecular formula C30H35F5O2 and a molecular weight of 522.60 g/mol. Its IUPAC name is 2,6-difluoro-4-[1-(4-pentylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 2,6-difluoro-4-[1-(4-pentylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 57001020 |
| Molecular Formula | C30H35F5O2 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 2,6-difluoro-4-[1-(4-pentylcyclohexyl)cyclohexyl]-3-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | CCCCCC1CCC(C2(c3cc(F)c(C(=O)O)c(F)c3-c3cc(F)c(F)c(F)c3)CCCCC2)CC1 |
| InChI | InChI=1S/C30H35F5O2/c1-2-3-5-8-18-9-11-20(12-10-18)30(13-6-4-7-14-30)21-17-22(31)26(29(36)37)28(35)25(21)19-15-23(32)27(34)24(33)16-19/h15-18,20H,2-14H2,1H3,(H,36,37) |
| InChIKey | ZRTISJVCLWKPNV-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|