C24H25F5O2 — CID 18410846
2,6-difluoro-4-(4-pentylcyclohexyl)-3-(3,4,5-trifluorophenyl)benzoic acid (PubChem CID 18410846) has the molecular formula C24H25F5O2 and a molecular weight of 440.45 g/mol. Its IUPAC name is 2,6-difluoro-4-(4-pentylcyclohexyl)-3-(3,4,5-trifluorophenyl)benzoic acid.
| Compound Name | 2,6-difluoro-4-(4-pentylcyclohexyl)-3-(3,4,5-trifluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 18410846 |
| Molecular Formula | C24H25F5O2 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2,6-difluoro-4-(4-pentylcyclohexyl)-3-(3,4,5-trifluorophenyl)benzoic acid |
| SMILES | CCCCCC1CCC(c2cc(F)c(C(=O)O)c(F)c2-c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H25F5O2/c1-2-3-4-5-13-6-8-14(9-7-13)16-12-17(25)21(24(30)31)23(29)20(16)15-10-18(26)22(28)19(27)11-15/h10-14H,2-9H2,1H3,(H,30,31) |
| InChIKey | FAVHDTYHYMSDCG-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|