C19H18F2N2S — CID 164525944
2,5-difluoro-3-isothiocyanato-6-[4-(4-methylcyclohexyl)phenyl]pyridine (PubChem CID 164525944) has the molecular formula C19H18F2N2S and a molecular weight of 344.43 g/mol. Its IUPAC name is 2,5-difluoro-3-isothiocyanato-6-[4-(4-methylcyclohexyl)phenyl]pyridine.
| Compound Name | 2,5-difluoro-3-isothiocyanato-6-[4-(4-methylcyclohexyl)phenyl]pyridine |
|---|---|
| PubChem CID | 164525944 |
| Molecular Formula | C19H18F2N2S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2,5-difluoro-3-isothiocyanato-6-[4-(4-methylcyclohexyl)phenyl]pyridine |
| SMILES | CC1CCC(c2ccc(-c3nc(F)c(N=C=S)cc3F)cc2)CC1 |
| InChI | InChI=1S/C19H18F2N2S/c1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)18-16(20)10-17(22-11-24)19(21)23-18/h6-10,12-13H,2-5H2,1H3 |
| InChIKey | UBFDPQSPRMINLL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|