C12H12FNO2S — CID 23534256
2-(3-fluoro-4-isothiocyanatophenyl)-5-methyl-1,3-dioxane (PubChem CID 23534256) has the molecular formula C12H12FNO2S and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(3-fluoro-4-isothiocyanatophenyl)-5-methyl-1,3-dioxane.
| Compound Name | 2-(3-fluoro-4-isothiocyanatophenyl)-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 23534256 |
| Molecular Formula | C12H12FNO2S |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-(3-fluoro-4-isothiocyanatophenyl)-5-methyl-1,3-dioxane |
| SMILES | CC1COC(c2ccc(N=C=S)c(F)c2)OC1 |
| InChI | InChI=1S/C12H12FNO2S/c1-8-5-15-12(16-6-8)9-2-3-11(14-7-17)10(13)4-9/h2-4,8,12H,5-6H2,1H3 |
| InChIKey | BLHFWVLBXVQZDC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|